C26H20Br2N4S4 — CID 122194386
1-(2-bromophenyl)-3-[2-[[2-[(2-bromophenyl)carbamothioylamino]phenyl]disulfanyl]phenyl]thiourea (PubChem CID 122194386) has the molecular formula C26H20Br2N4S4 and a molecular weight of 676.55 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[2-[[2-[(2-bromophenyl)carbamothioylamino]phenyl]disulfanyl]phenyl]thiourea.
| Compound Name | 1-(2-bromophenyl)-3-[2-[[2-[(2-bromophenyl)carbamothioylamino]phenyl]disulfanyl]phenyl]thiourea |
|---|---|
| PubChem CID | 122194386 |
| Molecular Formula | C26H20Br2N4S4 |
| Molecular Weight | 676.55 g/mol |
| Exact Mass | 673.89 |
| IUPAC Name | 1-(2-bromophenyl)-3-[2-[[2-[(2-bromophenyl)carbamothioylamino]phenyl]disulfanyl]phenyl]thiourea |
| SMILES | S=C(Nc1ccccc1Br)Nc1ccccc1SSc1ccccc1NC(=S)Nc1ccccc1Br |
| InChI | InChI=1S/C26H20Br2N4S4/c27-17-9-1-3-11-19(17)29-25(33)31-21-13-5-7-15-23(21)35-36-24-16-8-6-14-22(24)32-26(34)30-20-12-4-2-10-18(20)28/h1-16H,(H2,29,31,33)(H2,30,32,34) |
| InChIKey | NACYRCNWZKMJEI-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.55 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|