C23H33NO5S — CID 54407681
[2-(N-ethoxy-C-pentylcarbonimidoyl)-5,5-dimethyl-3-oxocyclohexen-1-yl] 4-methylbenzenesulfonate (PubChem CID 54407681) has the molecular formula C23H33NO5S and a molecular weight of 435.59 g/mol. Its IUPAC name is [2-(N-ethoxy-C-pentylcarbonimidoyl)-5,5-dimethyl-3-oxocyclohexen-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-(N-ethoxy-C-pentylcarbonimidoyl)-5,5-dimethyl-3-oxocyclohexen-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 54407681 |
| Molecular Formula | C23H33NO5S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | [2-(N-ethoxy-C-pentylcarbonimidoyl)-5,5-dimethyl-3-oxocyclohexen-1-yl] 4-methylbenzenesulfonate |
| SMILES | CCCCCC(=NOCC)C1=C(OS(=O)(=O)c2ccc(C)cc2)CC(C)(C)CC1=O |
| InChI | InChI=1S/C23H33NO5S/c1-6-8-9-10-19(24-28-7-2)22-20(25)15-23(4,5)16-21(22)29-30(26,27)18-13-11-17(3)12-14-18/h11-14H,6-10,15-16H2,1-5H3 |
| InChIKey | VRWQMXOKGVDACN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|