C15H20N2O5 — CID 54412017
3-(dihydroxymethyl)-N-[1-(dimethylamino)-1-oxo-3-phenylpropan-2-yl]oxirane-2-carboxamide (PubChem CID 54412017) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 3-(dihydroxymethyl)-N-[1-(dimethylamino)-1-oxo-3-phenylpropan-2-yl]oxirane-2-carboxamide.
| Compound Name | 3-(dihydroxymethyl)-N-[1-(dimethylamino)-1-oxo-3-phenylpropan-2-yl]oxirane-2-carboxamide |
|---|---|
| PubChem CID | 54412017 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3-(dihydroxymethyl)-N-[1-(dimethylamino)-1-oxo-3-phenylpropan-2-yl]oxirane-2-carboxamide |
| SMILES | CN(C)C(=O)C(Cc1ccccc1)NC(=O)C1OC1C(O)O |
| InChI | InChI=1S/C15H20N2O5/c1-17(2)14(19)10(8-9-6-4-3-5-7-9)16-13(18)11-12(22-11)15(20)21/h3-7,10-12,15,20-21H,8H2,1-2H3,(H,16,18) |
| InChIKey | VUUOVIMWMLPTTC-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|