C21H23N3O4S — CID 54413341
ethyl 3-(2-amino-3-propan-2-ylsulfonylbenzimidazol-5-yl)-3-phenylprop-2-enoate (PubChem CID 54413341) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is ethyl 3-(2-amino-3-propan-2-ylsulfonylbenzimidazol-5-yl)-3-phenylprop-2-enoate.
| Compound Name | ethyl 3-(2-amino-3-propan-2-ylsulfonylbenzimidazol-5-yl)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 54413341 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | ethyl 3-(2-amino-3-propan-2-ylsulfonylbenzimidazol-5-yl)-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)C=C(c1ccccc1)c1ccc2nc(N)n(S(=O)(=O)C(C)C)c2c1 |
| InChI | InChI=1S/C21H23N3O4S/c1-4-28-20(25)13-17(15-8-6-5-7-9-15)16-10-11-18-19(12-16)24(21(22)23-18)29(26,27)14(2)3/h5-14H,4H2,1-3H3,(H2,22,23) |
| InChIKey | VVRMLVBUHPSFOX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|