C21H18F3N3O2S — CID 6479384
1-propan-2-ylsulfonyl-6-[(E)-1-[3-(trifluoromethyl)phenyl]but-1-en-3-ynyl]benzimidazol-2-amine (PubChem CID 6479384) has the molecular formula C21H18F3N3O2S and a molecular weight of 433.46 g/mol. Its IUPAC name is 1-propan-2-ylsulfonyl-6-[(E)-1-[3-(trifluoromethyl)phenyl]but-1-en-3-ynyl]benzimidazol-2-amine.
| Compound Name | 1-propan-2-ylsulfonyl-6-[(E)-1-[3-(trifluoromethyl)phenyl]but-1-en-3-ynyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 6479384 |
| Molecular Formula | C21H18F3N3O2S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 1-propan-2-ylsulfonyl-6-[(E)-1-[3-(trifluoromethyl)phenyl]but-1-en-3-ynyl]benzimidazol-2-amine |
| SMILES | C#C/C=C(\c1cccc(C(F)(F)F)c1)c1ccc2nc(N)n(S(=O)(=O)C(C)C)c2c1 |
| InChI | InChI=1S/C21H18F3N3O2S/c1-4-6-17(14-7-5-8-16(11-14)21(22,23)24)15-9-10-18-19(12-15)27(20(25)26-18)30(28,29)13(2)3/h1,5-13H,2-3H3,(H2,25,26)/b17-6+ |
| InChIKey | BVHAUFWVAAAUTR-UBKPWBPPSA-N |
| XLogP | 4.29 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|