C10H16N2O — CID 54415725
2-(4,6-diethylpyrimidin-5-yl)ethanol (PubChem CID 54415725) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(4,6-diethylpyrimidin-5-yl)ethanol.
| Compound Name | 2-(4,6-diethylpyrimidin-5-yl)ethanol |
|---|---|
| PubChem CID | 54415725 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-(4,6-diethylpyrimidin-5-yl)ethanol |
| SMILES | CCc1ncnc(CC)c1CCO |
| InChI | InChI=1S/C10H16N2O/c1-3-9-8(5-6-13)10(4-2)12-7-11-9/h7,13H,3-6H2,1-2H3 |
| InChIKey | CXKGREGQIMBSLP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |