C20H34O4 — CID 544166
6-ethyl-1-(3-methoxy-3-oxopropyl)-2,6,8a-trimethyl-3,4,4a,5,7,8-hexahydro-1H-naphthalene-2-carboxylic acid (PubChem CID 544166) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 6-ethyl-1-(3-methoxy-3-oxopropyl)-2,6,8a-trimethyl-3,4,4a,5,7,8-hexahydro-1H-naphthalene-2-carboxylic acid.
| Compound Name | 6-ethyl-1-(3-methoxy-3-oxopropyl)-2,6,8a-trimethyl-3,4,4a,5,7,8-hexahydro-1H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 544166 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 6-ethyl-1-(3-methoxy-3-oxopropyl)-2,6,8a-trimethyl-3,4,4a,5,7,8-hexahydro-1H-naphthalene-2-carboxylic acid |
| SMILES | CCC1(C)CCC2(C)C(CCC(C)(C(=O)O)C2CCC(=O)OC)C1 |
| InChI | InChI=1S/C20H34O4/c1-6-18(2)11-12-19(3)14(13-18)9-10-20(4,17(22)23)15(19)7-8-16(21)24-5/h14-15H,6-13H2,1-5H3,(H,22,23) |
| InChIKey | UMEKPSPQZWAZKV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |