C25H21NO5 — CID 54417166
N-[3-[6-hydroxy-3-[(4-methoxyphenyl)methylidene]-4-oxochromen-2-yl]phenyl]acetamide (PubChem CID 54417166) has the molecular formula C25H21NO5 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-[3-[6-hydroxy-3-[(4-methoxyphenyl)methylidene]-4-oxochromen-2-yl]phenyl]acetamide.
| Compound Name | N-[3-[6-hydroxy-3-[(4-methoxyphenyl)methylidene]-4-oxochromen-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 54417166 |
| Molecular Formula | C25H21NO5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[3-[6-hydroxy-3-[(4-methoxyphenyl)methylidene]-4-oxochromen-2-yl]phenyl]acetamide |
| SMILES | COc1ccc(C=C2C(=O)c3cc(O)ccc3OC2c2cccc(NC(C)=O)c2)cc1 |
| InChI | InChI=1S/C25H21NO5/c1-15(27)26-18-5-3-4-17(13-18)25-22(12-16-6-9-20(30-2)10-7-16)24(29)21-14-19(28)8-11-23(21)31-25/h3-14,25,28H,1-2H3,(H,26,27) |
| InChIKey | VYGHGYRWKOWBKQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|