C28H33F3O2 — CID 54417307
ethyl 5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-[3-(trifluoromethyl)phenyl]pent-2-enoate (PubChem CID 54417307) has the molecular formula C28H33F3O2 and a molecular weight of 458.56 g/mol. Its IUPAC name is ethyl 5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-[3-(trifluoromethyl)phenyl]pent-2-enoate.
| Compound Name | ethyl 5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-[3-(trifluoromethyl)phenyl]pent-2-enoate |
|---|---|
| PubChem CID | 54417307 |
| Molecular Formula | C28H33F3O2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | ethyl 5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-[3-(trifluoromethyl)phenyl]pent-2-enoate |
| SMILES | CCOC(=O)C(=CCCc1ccc2c(c1)C(C)(C)CCC2(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H33F3O2/c1-6-33-25(32)22(20-10-8-11-21(18-20)28(29,30)31)12-7-9-19-13-14-23-24(17-19)27(4,5)16-15-26(23,2)3/h8,10-14,17-18H,6-7,9,15-16H2,1-5H3 |
| InChIKey | VYIPSQGOIYISJU-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|