C25H23N3O5 — CID 5441796
N-[(E)-3-(3-acetylanilino)-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]-3,4-dimethoxybenzamide (PubChem CID 5441796) has the molecular formula C25H23N3O5 and a molecular weight of 445.48 g/mol. Its IUPAC name is N-[(E)-3-(3-acetylanilino)-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(E)-3-(3-acetylanilino)-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 5441796 |
| Molecular Formula | C25H23N3O5 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[(E)-3-(3-acetylanilino)-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/C(=C/c2cccnc2)C(=O)Nc2cccc(C(C)=O)c2)cc1OC |
| InChI | InChI=1S/C25H23N3O5/c1-16(29)18-7-4-8-20(13-18)27-25(31)21(12-17-6-5-11-26-15-17)28-24(30)19-9-10-22(32-2)23(14-19)33-3/h4-15H,1-3H3,(H,27,31)(H,28,30)/b21-12+ |
| InChIKey | YTYKSGGXHYXALY-CIAFOILYSA-N |
| XLogP | 3.71 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|