C32H47N3O4 — CID 54418629
3-[(4-decoxybenzoyl)amino]-4-methoxy-N-(2-piperidin-1-ylethyl)benzamide (PubChem CID 54418629) has the molecular formula C32H47N3O4 and a molecular weight of 537.75 g/mol. Its IUPAC name is 3-[(4-decoxybenzoyl)amino]-4-methoxy-N-(2-piperidin-1-ylethyl)benzamide.
| Compound Name | 3-[(4-decoxybenzoyl)amino]-4-methoxy-N-(2-piperidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 54418629 |
| Molecular Formula | C32H47N3O4 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.36 |
| IUPAC Name | 3-[(4-decoxybenzoyl)amino]-4-methoxy-N-(2-piperidin-1-ylethyl)benzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Nc2cc(C(=O)NCCN3CCCCC3)ccc2OC)cc1 |
| InChI | InChI=1S/C32H47N3O4/c1-3-4-5-6-7-8-9-13-24-39-28-17-14-26(15-18-28)32(37)34-29-25-27(16-19-30(29)38-2)31(36)33-20-23-35-21-11-10-12-22-35/h14-19,25H,3-13,20-24H2,1-2H3,(H,33,36)(H,34,37) |
| InChIKey | VZFAUTOHTSPTCS-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|