C21H24O6S — CID 54421848
3-oxo-2-[2-[4-(2-phenylmethoxyethylsulfonyl)phenyl]ethyl]butanoic acid (PubChem CID 54421848) has the molecular formula C21H24O6S and a molecular weight of 404.48 g/mol. Its IUPAC name is 3-oxo-2-[2-[4-(2-phenylmethoxyethylsulfonyl)phenyl]ethyl]butanoic acid.
| Compound Name | 3-oxo-2-[2-[4-(2-phenylmethoxyethylsulfonyl)phenyl]ethyl]butanoic acid |
|---|---|
| PubChem CID | 54421848 |
| Molecular Formula | C21H24O6S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 3-oxo-2-[2-[4-(2-phenylmethoxyethylsulfonyl)phenyl]ethyl]butanoic acid |
| SMILES | CC(=O)C(CCc1ccc(S(=O)(=O)CCOCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C21H24O6S/c1-16(22)20(21(23)24)12-9-17-7-10-19(11-8-17)28(25,26)14-13-27-15-18-5-3-2-4-6-18/h2-8,10-11,20H,9,12-15H2,1H3,(H,23,24) |
| InChIKey | WBJHNRWIEHIUEH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|