C20H24O5S — CID 91234404
3-phenylpropyl 4-(benzenesulfonyl)-2-methoxybutanoate (PubChem CID 91234404) has the molecular formula C20H24O5S and a molecular weight of 376.47 g/mol. Its IUPAC name is 3-phenylpropyl 4-(benzenesulfonyl)-2-methoxybutanoate.
| Compound Name | 3-phenylpropyl 4-(benzenesulfonyl)-2-methoxybutanoate |
|---|---|
| PubChem CID | 91234404 |
| Molecular Formula | C20H24O5S |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 3-phenylpropyl 4-(benzenesulfonyl)-2-methoxybutanoate |
| SMILES | COC(CCS(=O)(=O)c1ccccc1)C(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C20H24O5S/c1-24-19(14-16-26(22,23)18-12-6-3-7-13-18)20(21)25-15-8-11-17-9-4-2-5-10-17/h2-7,9-10,12-13,19H,8,11,14-16H2,1H3 |
| InChIKey | UGWHUJKPXGZJOK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|