C19H31NO4S2 — CID 91337649
3-phenylpropyl (2S)-2-(3-methylbutylsulfonylamino)-4-methylsulfanylbutanoate (PubChem CID 91337649) has the molecular formula C19H31NO4S2 and a molecular weight of 401.59 g/mol. Its IUPAC name is 3-phenylpropyl (2S)-2-(3-methylbutylsulfonylamino)-4-methylsulfanylbutanoate.
| Compound Name | 3-phenylpropyl (2S)-2-(3-methylbutylsulfonylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 91337649 |
| Molecular Formula | C19H31NO4S2 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 3-phenylpropyl (2S)-2-(3-methylbutylsulfonylamino)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NS(=O)(=O)CCC(C)C)C(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C19H31NO4S2/c1-16(2)12-15-26(22,23)20-18(11-14-25-3)19(21)24-13-7-10-17-8-5-4-6-9-17/h4-6,8-9,16,18,20H,7,10-15H2,1-3H3/t18-/m0/s1 |
| InChIKey | CTJGJYFKIWGMFW-SFHVURJKSA-N |
| XLogP | 3.25 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|