C31H52O8S — CID 158816498
6-(benzenesulfonyl)-4-methoxyhexan-2-one;methane;4-(3-methoxy-5-oxohexyl)benzoic acid (PubChem CID 158816498) has the molecular formula C31H52O8S and a molecular weight of 584.82 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-4-methoxyhexan-2-one;methane;4-(3-methoxy-5-oxohexyl)benzoic acid.
| Compound Name | 6-(benzenesulfonyl)-4-methoxyhexan-2-one;methane;4-(3-methoxy-5-oxohexyl)benzoic acid |
|---|---|
| PubChem CID | 158816498 |
| Molecular Formula | C31H52O8S |
| Molecular Weight | 584.82 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | 6-(benzenesulfonyl)-4-methoxyhexan-2-one;methane;4-(3-methoxy-5-oxohexyl)benzoic acid |
| SMILES | C.C.C.C.COC(CCS(=O)(=O)c1ccccc1)CC(C)=O.COC(CCc1ccc(C(=O)O)cc1)CC(C)=O |
| InChI | InChI=1S/C14H18O4.C13H18O4S.4CH4/c1-10(15)9-13(18-2)8-5-11-3-6-12(7-4-11)14(16)17;1-11(14)10-12(17-2)8-9-18(15,16)13-6-4-3-5-7-13;;;;/h3-4,6-7,13H,5,8-9H2,1-2H3,(H,16,17);3-7,12H,8-10H2,1-2H3;4*1H4 |
| InChIKey | IVILHAUGBGVXQZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.82 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |