C12H16O4 — CID 21477511
4-(3,3-dimethoxypropyl)benzoic acid (PubChem CID 21477511) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-(3,3-dimethoxypropyl)benzoic acid.
| Compound Name | 4-(3,3-dimethoxypropyl)benzoic acid |
|---|---|
| PubChem CID | 21477511 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-(3,3-dimethoxypropyl)benzoic acid |
| SMILES | COC(CCc1ccc(C(=O)O)cc1)OC |
| InChI | InChI=1S/C12H16O4/c1-15-11(16-2)8-5-9-3-6-10(7-4-9)12(13)14/h3-4,6-7,11H,5,8H2,1-2H3,(H,13,14) |
| InChIKey | DIADHVOZOLDOCL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|