C16H25FO3 — CID 160891216
1-(4-fluorophenyl)-4-methoxyheptane-1,6-dione;methane (PubChem CID 160891216) has the molecular formula C16H25FO3 and a molecular weight of 284.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-methoxyheptane-1,6-dione;methane.
| Compound Name | 1-(4-fluorophenyl)-4-methoxyheptane-1,6-dione;methane |
|---|---|
| PubChem CID | 160891216 |
| Molecular Formula | C16H25FO3 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1-(4-fluorophenyl)-4-methoxyheptane-1,6-dione;methane |
| SMILES | C.C.COC(CCC(=O)c1ccc(F)cc1)CC(C)=O |
| InChI | InChI=1S/C14H17FO3.2CH4/c1-10(16)9-13(18-2)7-8-14(17)11-3-5-12(15)6-4-11;;/h3-6,13H,7-9H2,1-2H3;2*1H4 |
| InChIKey | SOHHMBQEOFSXTC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |