C19H13Cl2N3O3 — CID 54422123
N-(3,5-dichloro-4-pyridinyl)-4-methoxy-3-(pyridine-2-carbonyl)benzamide (PubChem CID 54422123) has the molecular formula C19H13Cl2N3O3 and a molecular weight of 402.24 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-4-methoxy-3-(pyridine-2-carbonyl)benzamide.
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-4-methoxy-3-(pyridine-2-carbonyl)benzamide |
|---|---|
| PubChem CID | 54422123 |
| Molecular Formula | C19H13Cl2N3O3 |
| Molecular Weight | 402.24 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-4-methoxy-3-(pyridine-2-carbonyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2c(Cl)cncc2Cl)cc1C(=O)c1ccccn1 |
| InChI | InChI=1S/C19H13Cl2N3O3/c1-27-16-6-5-11(8-12(16)18(25)15-4-2-3-7-23-15)19(26)24-17-13(20)9-22-10-14(17)21/h2-10H,1H3,(H,22,24,26) |
| InChIKey | WBOFWQMZHOGBOP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.24 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |