C10H18N3O14P3 — CID 54422357
[[[(2S,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]-methoxymethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 54422357) has the molecular formula C10H18N3O14P3 and a molecular weight of 497.18 g/mol. Its IUPAC name is [[[(2S,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]-methoxymethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[[(2S,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]-methoxymethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 54422357 |
| Molecular Formula | C10H18N3O14P3 |
| Molecular Weight | 497.18 g/mol |
| Exact Mass | 497.00 |
| IUPAC Name | [[[(2S,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]-methoxymethoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | COC(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H]1O[C@@H](n2ccc(N)nc2=O)C[C@@H]1O |
| InChI | InChI=1S/C10H18N3O14P3/c1-23-9(25-29(19,20)27-30(21,22)26-28(16,17)18)8-5(14)4-7(24-8)13-3-2-6(11)12-10(13)15/h2-3,5,7-9,14H,4H2,1H3,(H,19,20)(H,21,22)(H2,11,12,15)(H2,16,17,18)/t5-,7+,8-,9?/m0/s1 |
| InChIKey | WBRWLPBMTLCWPM-JMXVFPMBSA-N |
| XLogP | -1.21 |
| TPSA | 259.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.18 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|