About O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate
O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate (PubChem CID 54422420) has the molecular formula C8H10N2O2S
and a molecular weight of 198.25 g/mol. Its IUPAC name is O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate.
Molecular Properties
| Compound Name | O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate |
| PubChem CID | 54422420 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate |
| SMILES | CNC(=S)Oc1cccc(OC)n1 |
| InChI | InChI=1S/C8H10N2O2S/c1-9-8(13)12-7-5-3-4-6(10-7)11-2/h3-5H,1-2H3,(H,9,13) |
| InChIKey | WBSXMJWFBKLMRS-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate?
The IUPAC name of O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate (CID 54422420) is O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate.
What is the SMILES notation for O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate?
The canonical SMILES for O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate is CNC(=S)Oc1cccc(OC)n1.
What is the InChIKey of O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate?
The InChIKey is WBSXMJWFBKLMRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2S/c1-9-8(13)12-7-5-3-4-6(10-7)11-2/h3-5H,1-2H3,(H,9,13).
What are the key properties of O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate?
O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate has a molecular weight of 198.25 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(6-methoxy-2-pyridinyl)] N-methylcarbamothioate is sourced from PubChem (CID 54422420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).