C15H13NO3 — CID 156773654
1-(6-methoxy-2-pyridinyl)-3-phenylpropane-1,3-dione (PubChem CID 156773654) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-(6-methoxy-2-pyridinyl)-3-phenylpropane-1,3-dione.
| Compound Name | 1-(6-methoxy-2-pyridinyl)-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 156773654 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-(6-methoxy-2-pyridinyl)-3-phenylpropane-1,3-dione |
| SMILES | COc1cccc(C(=O)CC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C15H13NO3/c1-19-15-9-5-8-12(16-15)14(18)10-13(17)11-6-3-2-4-7-11/h2-9H,10H2,1H3 |
| InChIKey | HSRXYSRZVUITBV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|