C33H37N3O8 — CID 54423525
benzyl (3S)-3-amino-7-[benzyl-(2-methoxy-2-oxoethyl)amino]-5-methyl-4,7-dioxo-6-(phenylmethoxycarbonylamino)heptanoate (PubChem CID 54423525) has the molecular formula C33H37N3O8 and a molecular weight of 603.67 g/mol. Its IUPAC name is benzyl (3S)-3-amino-7-[benzyl-(2-methoxy-2-oxoethyl)amino]-5-methyl-4,7-dioxo-6-(phenylmethoxycarbonylamino)heptanoate.
| Compound Name | benzyl (3S)-3-amino-7-[benzyl-(2-methoxy-2-oxoethyl)amino]-5-methyl-4,7-dioxo-6-(phenylmethoxycarbonylamino)heptanoate |
|---|---|
| PubChem CID | 54423525 |
| Molecular Formula | C33H37N3O8 |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 603.26 |
| IUPAC Name | benzyl (3S)-3-amino-7-[benzyl-(2-methoxy-2-oxoethyl)amino]-5-methyl-4,7-dioxo-6-(phenylmethoxycarbonylamino)heptanoate |
| SMILES | COC(=O)CN(Cc1ccccc1)C(=O)C(NC(=O)OCc1ccccc1)C(C)C(=O)[C@@H](N)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H37N3O8/c1-23(31(39)27(34)18-28(37)43-21-25-14-8-4-9-15-25)30(35-33(41)44-22-26-16-10-5-11-17-26)32(40)36(20-29(38)42-2)19-24-12-6-3-7-13-24/h3-17,23,27,30H,18-22,34H2,1-2H3,(H,35,41)/t23?,27-,30?/m0/s1 |
| InChIKey | WCMAIAOPRDTNLT-VTIINTLQSA-N |
| XLogP | 3.15 |
| TPSA | 154.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|