C19H12Cl2N2O2 — CID 5442508
[(E)-[phenyl(pyridin-2-yl)methylidene]amino] 3,4-dichlorobenzoate (PubChem CID 5442508) has the molecular formula C19H12Cl2N2O2 and a molecular weight of 371.22 g/mol. Its IUPAC name is [(E)-[phenyl(pyridin-2-yl)methylidene]amino] 3,4-dichlorobenzoate.
| Compound Name | [(E)-[phenyl(pyridin-2-yl)methylidene]amino] 3,4-dichlorobenzoate |
|---|---|
| PubChem CID | 5442508 |
| Molecular Formula | C19H12Cl2N2O2 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | [(E)-[phenyl(pyridin-2-yl)methylidene]amino] 3,4-dichlorobenzoate |
| SMILES | O=C(O/N=C(\c1ccccc1)c1ccccn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2N2O2/c20-15-10-9-14(12-16(15)21)19(24)25-23-18(13-6-2-1-3-7-13)17-8-4-5-11-22-17/h1-12H/b23-18+ |
| InChIKey | BVUYZMGFPSBKAO-PTGBLXJZSA-N |
| XLogP | 5.00 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|