C14H9Cl2NO3 — CID 902793
[2-(3,4-dichlorophenyl)-2-oxoethyl] pyridine-4-carboxylate (PubChem CID 902793) has the molecular formula C14H9Cl2NO3 and a molecular weight of 310.14 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] pyridine-4-carboxylate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 902793 |
| Molecular Formula | C14H9Cl2NO3 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] pyridine-4-carboxylate |
| SMILES | O=C(COC(=O)c1ccncc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2NO3/c15-11-2-1-10(7-12(11)16)13(18)8-20-14(19)9-3-5-17-6-4-9/h1-7H,8H2 |
| InChIKey | PTCJEQBJDABWCV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |