C34H46O11 — CID 54426961
[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 54426961) has the molecular formula C34H46O11 and a molecular weight of 630.73 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 54426961 |
| Molecular Formula | C34H46O11 |
| Molecular Weight | 630.73 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl] 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(=O)C=C(C)C=CC=C(C)C=CC2=C(C)CCCC2(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C34H46O11/c1-20(15-16-27-22(3)14-11-17-34(27,8)9)12-10-13-21(2)18-29(39)45-33-32(43-26(7)38)31(42-25(6)37)30(41-24(5)36)28(44-33)19-40-23(4)35/h10,12-13,15-16,18,28,30-33H,11,14,17,19H2,1-9H3/t28-,30+,31+,32-,33+/m1/s1 |
| InChIKey | WETZZKRCFFEATR-IROHOENBSA-N |
| XLogP | 5.14 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.73 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|