C24H24N2O4S2 — CID 54427268
benzhydryl (6R,7R)-3-[acetylsulfanyl(amino)methyl]-7-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54427268) has the molecular formula C24H24N2O4S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is benzhydryl (6R,7R)-3-[acetylsulfanyl(amino)methyl]-7-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-3-[acetylsulfanyl(amino)methyl]-7-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54427268 |
| Molecular Formula | C24H24N2O4S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | benzhydryl (6R,7R)-3-[acetylsulfanyl(amino)methyl]-7-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)SC(N)C1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)[C@@H](C)[C@H]2SC1 |
| InChI | InChI=1S/C24H24N2O4S2/c1-14-22(28)26-19(18(13-31-23(14)26)21(25)32-15(2)27)24(29)30-20(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,14,20-21,23H,13,25H2,1-2H3/t14-,21?,23-/m1/s1 |
| InChIKey | WEZCUFLGBHXMGU-YSKCATNHSA-N |
| XLogP | 3.69 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|