C13H9F6NO2 — CID 54427695
1-[3,5-bis(trifluoromethyl)phenyl]-3-methylpyrrole-2,5-diol (PubChem CID 54427695) has the molecular formula C13H9F6NO2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-methylpyrrole-2,5-diol.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-methylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 54427695 |
| Molecular Formula | C13H9F6NO2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-methylpyrrole-2,5-diol |
| SMILES | Cc1cc(O)n(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C13H9F6NO2/c1-6-2-10(21)20(11(6)22)9-4-7(12(14,15)16)3-8(5-9)13(17,18)19/h2-5,21-22H,1H3 |
| InChIKey | WFHBEPNMEBJLKG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |