About 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate
3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate (PubChem CID 54434658) has the molecular formula C12H22O6
and a molecular weight of 262.30 g/mol. Its IUPAC name is 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate.
Molecular Properties
| Compound Name | 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate |
| PubChem CID | 54434658 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate |
| SMILES | CC(=O)OC(C)C(C)=O.CC(=O)OC(C)C(C)O |
| InChI | InChI=1S/C6H12O3.C6H10O3/c2*1-4(7)5(2)9-6(3)8/h4-5,7H,1-3H3;5H,1-3H3 |
| InChIKey | WJWYESRRTMQPBR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate?
The IUPAC name of 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate (CID 54434658) is 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate.
What is the SMILES notation for 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate?
The canonical SMILES for 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate is CC(=O)OC(C)C(C)=O.CC(=O)OC(C)C(C)O.
What is the InChIKey of 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate?
The InChIKey is WJWYESRRTMQPBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C6H10O3/c2*1-4(7)5(2)9-6(3)8/h4-5,7H,1-3H3;5H,1-3H3.
What are the key properties of 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate?
3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate has a molecular weight of 262.30 g/mol, XLogP of 0.85, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxybutan-2-yl acetate;3-oxobutan-2-yl acetate is sourced from PubChem (CID 54434658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).