C20H28N2S — CID 54436362
1-N,2-N-di(butan-2-yl)-3-phenylsulfanylbenzene-1,2-diamine (PubChem CID 54436362) has the molecular formula C20H28N2S and a molecular weight of 328.53 g/mol. Its IUPAC name is 1-N,2-N-di(butan-2-yl)-3-phenylsulfanylbenzene-1,2-diamine.
| Compound Name | 1-N,2-N-di(butan-2-yl)-3-phenylsulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 54436362 |
| Molecular Formula | C20H28N2S |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 1-N,2-N-di(butan-2-yl)-3-phenylsulfanylbenzene-1,2-diamine |
| SMILES | CCC(C)Nc1cccc(Sc2ccccc2)c1NC(C)CC |
| InChI | InChI=1S/C20H28N2S/c1-5-15(3)21-18-13-10-14-19(20(18)22-16(4)6-2)23-17-11-8-7-9-12-17/h7-16,21-22H,5-6H2,1-4H3 |
| InChIKey | WKZYPWUKLQHOSI-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |