C22H32N2S — CID 54187382
1-N,2-N-di(pentan-2-yl)-3-phenylsulfanylbenzene-1,2-diamine (PubChem CID 54187382) has the molecular formula C22H32N2S and a molecular weight of 356.58 g/mol. Its IUPAC name is 1-N,2-N-di(pentan-2-yl)-3-phenylsulfanylbenzene-1,2-diamine.
| Compound Name | 1-N,2-N-di(pentan-2-yl)-3-phenylsulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 54187382 |
| Molecular Formula | C22H32N2S |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-N,2-N-di(pentan-2-yl)-3-phenylsulfanylbenzene-1,2-diamine |
| SMILES | CCCC(C)Nc1cccc(Sc2ccccc2)c1NC(C)CCC |
| InChI | InChI=1S/C22H32N2S/c1-5-11-17(3)23-20-15-10-16-21(22(20)24-18(4)12-6-2)25-19-13-8-7-9-14-19/h7-10,13-18,23-24H,5-6,11-12H2,1-4H3 |
| InChIKey | PGANMPHSZSQALO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |