C22H36N4O6 — CID 54437330
(2S)-2-[[(2S)-3-carboxy-2-(10-imidazol-1-yldecanoylamino)propanoyl]amino]-3-methylbutanoic acid (PubChem CID 54437330) has the molecular formula C22H36N4O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-carboxy-2-(10-imidazol-1-yldecanoylamino)propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-carboxy-2-(10-imidazol-1-yldecanoylamino)propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 54437330 |
| Molecular Formula | C22H36N4O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (2S)-2-[[(2S)-3-carboxy-2-(10-imidazol-1-yldecanoylamino)propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)CCCCCCCCCn1ccnc1)C(=O)O |
| InChI | InChI=1S/C22H36N4O6/c1-16(2)20(22(31)32)25-21(30)17(14-19(28)29)24-18(27)10-8-6-4-3-5-7-9-12-26-13-11-23-15-26/h11,13,15-17,20H,3-10,12,14H2,1-2H3,(H,24,27)(H,25,30)(H,28,29)(H,31,32)/t17-,20-/m0/s1 |
| InChIKey | WLQPZLCPRURPPL-PXNSSMCTSA-N |
| XLogP | 2.19 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|