C18H21N5O3 — CID 54438613
3-[[6-(4-pyridin-4-ylpiperazin-1-yl)pyridine-2-carbonyl]amino]propanoic acid (PubChem CID 54438613) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 3-[[6-(4-pyridin-4-ylpiperazin-1-yl)pyridine-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[6-(4-pyridin-4-ylpiperazin-1-yl)pyridine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54438613 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 3-[[6-(4-pyridin-4-ylpiperazin-1-yl)pyridine-2-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1cccc(N2CCN(c3ccncc3)CC2)n1 |
| InChI | InChI=1S/C18H21N5O3/c24-17(25)6-9-20-18(26)15-2-1-3-16(21-15)23-12-10-22(11-13-23)14-4-7-19-8-5-14/h1-5,7-8H,6,9-13H2,(H,20,26)(H,24,25) |
| InChIKey | WMMPVECYPWWCOS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |