C10H14F2N4O4 — CID 54438941
2,2-difluoro-N-(4-hydroxybutyl)-3-(2-nitro-1H-imidazol-5-yl)propanamide (PubChem CID 54438941) has the molecular formula C10H14F2N4O4 and a molecular weight of 292.24 g/mol. Its IUPAC name is 2,2-difluoro-N-(4-hydroxybutyl)-3-(2-nitro-1H-imidazol-5-yl)propanamide.
| Compound Name | 2,2-difluoro-N-(4-hydroxybutyl)-3-(2-nitro-1H-imidazol-5-yl)propanamide |
|---|---|
| PubChem CID | 54438941 |
| Molecular Formula | C10H14F2N4O4 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2,2-difluoro-N-(4-hydroxybutyl)-3-(2-nitro-1H-imidazol-5-yl)propanamide |
| SMILES | O=C(NCCCCO)C(F)(F)Cc1cnc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C10H14F2N4O4/c11-10(12,8(18)13-3-1-2-4-17)5-7-6-14-9(15-7)16(19)20/h6,17H,1-5H2,(H,13,18)(H,14,15) |
| InChIKey | WMSCLTHJCHJGQG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|