C26H27NO3 — CID 54447235
1-(3-hydroxyphenyl)-3-[(3S,4S)-4-phenoxy-3-phenylpiperidin-1-yl]propan-1-one (PubChem CID 54447235) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-(3-hydroxyphenyl)-3-[(3S,4S)-4-phenoxy-3-phenylpiperidin-1-yl]propan-1-one.
| Compound Name | 1-(3-hydroxyphenyl)-3-[(3S,4S)-4-phenoxy-3-phenylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 54447235 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-(3-hydroxyphenyl)-3-[(3S,4S)-4-phenoxy-3-phenylpiperidin-1-yl]propan-1-one |
| SMILES | O=C(CCN1CC[C@H](Oc2ccccc2)[C@@H](c2ccccc2)C1)c1cccc(O)c1 |
| InChI | InChI=1S/C26H27NO3/c28-22-11-7-10-21(18-22)25(29)14-16-27-17-15-26(30-23-12-5-2-6-13-23)24(19-27)20-8-3-1-4-9-20/h1-13,18,24,26,28H,14-17,19H2/t24-,26+/m1/s1 |
| InChIKey | WSJOICNWTBTQCF-RSXGOPAZSA-N |
| XLogP | 4.90 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |