About 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one
1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one (PubChem CID 178137350) has the molecular formula C26H25NO3
and a molecular weight of 399.49 g/mol. Its IUPAC name is 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one |
| PubChem CID | 178137350 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one |
| SMILES | CC1CN(CCC(=O)c2ccc3cc4c(cc3c2)OC=CO4)CC1c1ccccc1 |
| InChI | InChI=1S/C26H25NO3/c1-18-16-27(17-23(18)19-5-3-2-4-6-19)10-9-24(28)21-8-7-20-14-25-26(15-22(20)13-21)30-12-11-29-25/h2-8,11-15,18,23H,9-10,16-17H2,1H3 |
| InChIKey | HLURIIJPWRTUFD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one?
The IUPAC name of 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one (CID 178137350) is 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one.
What is the SMILES notation for 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one?
The canonical SMILES for 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one is CC1CN(CCC(=O)c2ccc3cc4c(cc3c2)OC=CO4)CC1c1ccccc1.
What is the InChIKey of 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one?
The InChIKey is HLURIIJPWRTUFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25NO3/c1-18-16-27(17-23(18)19-5-3-2-4-6-19)10-9-24(28)21-8-7-20-14-25-26(15-22(20)13-21)30-12-11-29-25/h2-8,11-15,18,23H,9-10,16-17H2,1H3.
What are the key properties of 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one?
1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one has a molecular weight of 399.49 g/mol, XLogP of 5.39, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzo[g][1,4]benzodioxin-7-yl-3-(3-methyl-4-phenylpyrrolidin-1-yl)propan-1-one is sourced from PubChem (CID 178137350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).