C8H17N3O3 — CID 54447441
[4-(3-hydroxypropyl)piperazin-1-yl]carbamic acid (PubChem CID 54447441) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is [4-(3-hydroxypropyl)piperazin-1-yl]carbamic acid.
| Compound Name | [4-(3-hydroxypropyl)piperazin-1-yl]carbamic acid |
|---|---|
| PubChem CID | 54447441 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | [4-(3-hydroxypropyl)piperazin-1-yl]carbamic acid |
| SMILES | O=C(O)NN1CCN(CCCO)CC1 |
| InChI | InChI=1S/C8H17N3O3/c12-7-1-2-10-3-5-11(6-4-10)9-8(13)14/h9,12H,1-7H2,(H,13,14) |
| InChIKey | WSNLQBABICDVAH-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |