About CID 54448935
CID 54448935 (PubChem CID 54448935) has the molecular formula C6H14BClN
and a molecular weight of 146.45 g/mol.
Molecular Properties
| Compound Name | CID 54448935 |
| PubChem CID | 54448935 |
| Molecular Formula | C6H14BClN |
| Molecular Weight | 146.45 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | — |
| SMILES | CC(C)N([B]Cl)C(C)C |
| InChI | InChI=1S/C6H14BClN/c1-5(2)9(7-8)6(3)4/h5-6H,1-4H3 |
| InChIKey | BTURLNFMKBTTPU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 54448935 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 54448935?
The IUPAC name of CID 54448935 (CID 54448935) is not available.
What is the SMILES notation for CID 54448935?
The canonical SMILES for CID 54448935 is CC(C)N([B]Cl)C(C)C.
What is the InChIKey of CID 54448935?
The InChIKey is BTURLNFMKBTTPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14BClN/c1-5(2)9(7-8)6(3)4/h5-6H,1-4H3.
What are the key properties of CID 54448935?
CID 54448935 has a molecular weight of 146.45 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 54448935 is sourced from PubChem (CID 54448935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).