C16H11F3N2O3 — CID 54449768
4-phenylmethoxy-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione (PubChem CID 54449768) has the molecular formula C16H11F3N2O3 and a molecular weight of 336.27 g/mol. Its IUPAC name is 4-phenylmethoxy-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione.
| Compound Name | 4-phenylmethoxy-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 54449768 |
| Molecular Formula | C16H11F3N2O3 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 4-phenylmethoxy-6-(trifluoromethyl)-1H-quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(C(F)(F)F)cc2n(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C16H11F3N2O3/c17-16(18,19)11-6-7-12-13(8-11)21(15(23)14(22)20-12)24-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,20,22) |
| InChIKey | WUCNYPXBEKOKOL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|