C10H12F6O2 — CID 54450106
7,7,8,9,10,10-hexafluorodec-8-enoic acid (PubChem CID 54450106) has the molecular formula C10H12F6O2 and a molecular weight of 278.19 g/mol. Its IUPAC name is 7,7,8,9,10,10-hexafluorodec-8-enoic acid.
| Compound Name | 7,7,8,9,10,10-hexafluorodec-8-enoic acid |
|---|---|
| PubChem CID | 54450106 |
| Molecular Formula | C10H12F6O2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 7,7,8,9,10,10-hexafluorodec-8-enoic acid |
| SMILES | O=C(O)CCCCCC(F)(F)C(F)=C(F)C(F)F |
| InChI | InChI=1S/C10H12F6O2/c11-7(9(13)14)8(12)10(15,16)5-3-1-2-4-6(17)18/h9H,1-5H2,(H,17,18) |
| InChIKey | WUIXDRPPMANGJF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|