C11H16N2O3 — CID 54455314
N-[[4-(3-amino-2-hydroxypropoxy)phenyl]methyl]formamide (PubChem CID 54455314) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is N-[[4-(3-amino-2-hydroxypropoxy)phenyl]methyl]formamide.
| Compound Name | N-[[4-(3-amino-2-hydroxypropoxy)phenyl]methyl]formamide |
|---|---|
| PubChem CID | 54455314 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-[[4-(3-amino-2-hydroxypropoxy)phenyl]methyl]formamide |
| SMILES | NCC(O)COc1ccc(CNC=O)cc1 |
| InChI | InChI=1S/C11H16N2O3/c12-5-10(15)7-16-11-3-1-9(2-4-11)6-13-8-14/h1-4,8,10,15H,5-7,12H2,(H,13,14) |
| InChIKey | WXUPDUMGENFTNA-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|