About cyclohexane-1,1-dicarbonitrile
cyclohexane-1,1-dicarbonitrile (PubChem CID 544561) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is cyclohexane-1,1-dicarbonitrile.
Molecular Properties
| Compound Name | cyclohexane-1,1-dicarbonitrile |
| PubChem CID | 544561 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | cyclohexane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)CCCCC1 |
| InChI | InChI=1S/C8H10N2/c9-6-8(7-10)4-2-1-3-5-8/h1-5H2 |
| InChIKey | WMEXDXWNPYTTQQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexane-1,1-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,1-dicarbonitrile?
The IUPAC name of cyclohexane-1,1-dicarbonitrile (CID 544561) is cyclohexane-1,1-dicarbonitrile.
What is the SMILES notation for cyclohexane-1,1-dicarbonitrile?
The canonical SMILES for cyclohexane-1,1-dicarbonitrile is N#CC1(C#N)CCCCC1.
What is the InChIKey of cyclohexane-1,1-dicarbonitrile?
The InChIKey is WMEXDXWNPYTTQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c9-6-8(7-10)4-2-1-3-5-8/h1-5H2.
What are the key properties of cyclohexane-1,1-dicarbonitrile?
cyclohexane-1,1-dicarbonitrile has a molecular weight of 134.18 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,1-dicarbonitrile is sourced from PubChem (CID 544561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).