C23H41NO2 — CID 54456346
1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]octadeca-9,12-dien-1-one (PubChem CID 54456346) has the molecular formula C23H41NO2 and a molecular weight of 363.59 g/mol. Its IUPAC name is 1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]octadeca-9,12-dien-1-one.
| Compound Name | 1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]octadeca-9,12-dien-1-one |
|---|---|
| PubChem CID | 54456346 |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | 1-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]octadeca-9,12-dien-1-one |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C23H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-23(26)24-20-17-18-22(24)21-25/h6-7,9-10,22,25H,2-5,8,11-21H2,1H3/t22-/m0/s1 |
| InChIKey | WYLAPGAEAUSCGB-QFIPXVFZSA-N |
| XLogP | 5.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|