C22H41NO2 — CID 46934878
(Z,12R)-12-hydroxy-1-pyrrolidin-1-yloctadec-9-en-1-one (PubChem CID 46934878) has the molecular formula C22H41NO2 and a molecular weight of 351.58 g/mol. Its IUPAC name is (Z,12R)-12-hydroxy-1-pyrrolidin-1-yloctadec-9-en-1-one.
| Compound Name | (Z,12R)-12-hydroxy-1-pyrrolidin-1-yloctadec-9-en-1-one |
|---|---|
| PubChem CID | 46934878 |
| Molecular Formula | C22H41NO2 |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.31 |
| IUPAC Name | (Z,12R)-12-hydroxy-1-pyrrolidin-1-yloctadec-9-en-1-one |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C22H41NO2/c1-2-3-4-11-16-21(24)17-12-9-7-5-6-8-10-13-18-22(25)23-19-14-15-20-23/h9,12,21,24H,2-8,10-11,13-20H2,1H3/b12-9-/t21-/m1/s1 |
| InChIKey | ONIVXONBIIIQQH-ZDKIGPTLSA-N |
| XLogP | 5.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|