About Ricinoleic diethanolamide
Ricinoleic diethanolamide (PubChem CID 6441625) has the molecular formula C22H43NO4
and a molecular weight of 385.60 g/mol. Its IUPAC name is (Z,12R)-12-hydroxy-N,N-bis(2-hydroxyethyl)octadec-9-enamide.
Molecular Properties
| Compound Name | Ricinoleic diethanolamide |
| PubChem CID | 6441625 |
| Molecular Formula | C22H43NO4 |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.32 |
| IUPAC Name | (Z,12R)-12-hydroxy-N,N-bis(2-hydroxyethyl)octadec-9-enamide |
| SMILES | CCCCCC[C@H](C/C=C\CCCCCCCC(=O)N(CCO)CCO)O |
| InChI | InChI=1S/C22H43NO4/c1-2-3-4-11-14-21(26)15-12-9-7-5-6-8-10-13-16-22(27)23(17-19-24)18-20-25/h9,12,21,24-26H,2-8,10-11,13-20H2,1H3/b12-9-/t21-/m1/s1 |
| InChIKey | PDVQCPFKYPYROG-ZDKIGPTLSA-N |
| XLogP | 4.30 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | 354 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Ricinoleic diethanolamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ricinoleic diethanolamide?
The IUPAC name of Ricinoleic diethanolamide (CID 6441625) is (Z,12R)-12-hydroxy-N,N-bis(2-hydroxyethyl)octadec-9-enamide.
What is the SMILES notation for Ricinoleic diethanolamide?
The canonical SMILES for Ricinoleic diethanolamide is CCCCCC[C@H](C/C=C\CCCCCCCC(=O)N(CCO)CCO)O.
What is the InChIKey of Ricinoleic diethanolamide?
The InChIKey is PDVQCPFKYPYROG-ZDKIGPTLSA-N. The full InChI is InChI=1S/C22H43NO4/c1-2-3-4-11-14-21(26)15-12-9-7-5-6-8-10-13-16-22(27)23(17-19-24)18-20-25/h9,12,21,24-26H,2-8,10-11,13-20H2,1H3/b12-9-/t21-/m1/s1.
What are the key properties of Ricinoleic diethanolamide?
Ricinoleic diethanolamide has a molecular weight of 385.60 g/mol, XLogP of 4.30, 19 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Ricinoleic diethanolamide is sourced from PubChem (CID 6441625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).