C22H19N5O4 — CID 54456511
2-[4-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]-5-nitrobenzaldehyde (PubChem CID 54456511) has the molecular formula C22H19N5O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is 2-[4-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]-5-nitrobenzaldehyde.
| Compound Name | 2-[4-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]-5-nitrobenzaldehyde |
|---|---|
| PubChem CID | 54456511 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-[4-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidin-5-yl)phenoxy]-5-nitrobenzaldehyde |
| SMILES | CC(C)n1cc(-c2ccc(Oc3ccc([N+](=O)[O-])cc3C=O)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C22H19N5O4/c1-13(2)26-10-18(20-21(23)24-12-25-22(20)26)14-3-6-17(7-4-14)31-19-8-5-16(27(29)30)9-15(19)11-28/h3-13H,1-2H3,(H2,23,24,25) |
| InChIKey | WYOBSAHOJNFWPX-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|