C13H14N4O4S — CID 54456959
methyl 2-[[2-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]acetate (PubChem CID 54456959) has the molecular formula C13H14N4O4S and a molecular weight of 322.35 g/mol. Its IUPAC name is methyl 2-[[2-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 54456959 |
| Molecular Formula | C13H14N4O4S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | methyl 2-[[2-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)CSc1nnc(-c2ccc(N)cc2)o1 |
| InChI | InChI=1S/C13H14N4O4S/c1-20-11(19)6-15-10(18)7-22-13-17-16-12(21-13)8-2-4-9(14)5-3-8/h2-5H,6-7,14H2,1H3,(H,15,18) |
| InChIKey | WYWHBOHHCDNWAE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|