C15H19FO4 — CID 54459390
(4aS,6R,7S,7aR)-6-ethyl-7-[(2-fluorophenyl)methoxy]-2,3,4a,6,7,7a-hexahydrofuro[2,3-b][1,4]dioxine (PubChem CID 54459390) has the molecular formula C15H19FO4 and a molecular weight of 282.31 g/mol. Its IUPAC name is (4aS,6R,7S,7aR)-6-ethyl-7-[(2-fluorophenyl)methoxy]-2,3,4a,6,7,7a-hexahydrofuro[2,3-b][1,4]dioxine.
| Compound Name | (4aS,6R,7S,7aR)-6-ethyl-7-[(2-fluorophenyl)methoxy]-2,3,4a,6,7,7a-hexahydrofuro[2,3-b][1,4]dioxine |
|---|---|
| PubChem CID | 54459390 |
| Molecular Formula | C15H19FO4 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (4aS,6R,7S,7aR)-6-ethyl-7-[(2-fluorophenyl)methoxy]-2,3,4a,6,7,7a-hexahydrofuro[2,3-b][1,4]dioxine |
| SMILES | CC[C@H]1O[C@@H]2OCCO[C@@H]2[C@H]1OCc1ccccc1F |
| InChI | InChI=1S/C15H19FO4/c1-2-12-13(14-15(20-12)18-8-7-17-14)19-9-10-5-3-4-6-11(10)16/h3-6,12-15H,2,7-9H2,1H3/t12-,13+,14-,15+/m1/s1 |
| InChIKey | XANOZNOQSZUSKA-BARDWOONSA-N |
| XLogP | 2.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |