C16H21FO4 — CID 22825461
(3aR,5R,6S,6aR)-2-ethyl-6-[(2-fluorophenyl)methoxy]-2,5-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 22825461) has the molecular formula C16H21FO4 and a molecular weight of 296.34 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2-ethyl-6-[(2-fluorophenyl)methoxy]-2,5-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2-ethyl-6-[(2-fluorophenyl)methoxy]-2,5-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 22825461 |
| Molecular Formula | C16H21FO4 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (3aR,5R,6S,6aR)-2-ethyl-6-[(2-fluorophenyl)methoxy]-2,5-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCC1(C)O[C@H]2O[C@H](C)[C@H](OCc3ccccc3F)[C@H]2O1 |
| InChI | InChI=1S/C16H21FO4/c1-4-16(3)20-14-13(10(2)19-15(14)21-16)18-9-11-7-5-6-8-12(11)17/h5-8,10,13-15H,4,9H2,1-3H3/t10-,13+,14-,15-,16?/m1/s1 |
| InChIKey | SAZRZKKCXQAUHC-UQNYZGSNSA-N |
| XLogP | 3.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |