C11H17F3O5 — CID 54462913
trifluoromethyl 3,4,5-trimethoxycyclohexane-1-carboxylate (PubChem CID 54462913) has the molecular formula C11H17F3O5 and a molecular weight of 286.25 g/mol. Its IUPAC name is trifluoromethyl 3,4,5-trimethoxycyclohexane-1-carboxylate.
| Compound Name | trifluoromethyl 3,4,5-trimethoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54462913 |
| Molecular Formula | C11H17F3O5 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | trifluoromethyl 3,4,5-trimethoxycyclohexane-1-carboxylate |
| SMILES | COC1CC(C(=O)OC(F)(F)F)CC(OC)C1OC |
| InChI | InChI=1S/C11H17F3O5/c1-16-7-4-6(10(15)19-11(12,13)14)5-8(17-2)9(7)18-3/h6-9H,4-5H2,1-3H3 |
| InChIKey | XCVYSZFSSLRSEX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |