C22H19NO2 — CID 54471111
methyl 2-(2,2-diphenylethylideneamino)benzoate (PubChem CID 54471111) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl 2-(2,2-diphenylethylideneamino)benzoate.
| Compound Name | methyl 2-(2,2-diphenylethylideneamino)benzoate |
|---|---|
| PubChem CID | 54471111 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | methyl 2-(2,2-diphenylethylideneamino)benzoate |
| SMILES | COC(=O)c1ccccc1/N=C/C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO2/c1-25-22(24)19-14-8-9-15-21(19)23-16-20(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-16,20H,1H3/b23-16+ |
| InChIKey | XIKXLQMUNBQVFN-XQNSMLJCSA-N |
| XLogP | 5.01 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|